C18H22F3NO4 — CID 139573428
tert-butyl N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]cyclohexyl]carbamate (PubChem CID 139573428) has the molecular formula C18H22F3NO4 and a molecular weight of 373.37 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 139573428 |
| Molecular Formula | C18H22F3NO4 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | tert-butyl N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2cccc(OC(F)(F)F)c2)CCCCC1=O |
| InChI | InChI=1S/C18H22F3NO4/c1-16(2,3)26-15(24)22-17(10-5-4-9-14(17)23)12-7-6-8-13(11-12)25-18(19,20)21/h6-8,11H,4-5,9-10H2,1-3H3,(H,22,24) |
| InChIKey | NQPKQODMSMJRQD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |