C13H7Cl3F3N3O2 — CID 175721929
1-[3-chloro-5-(trifluoromethoxy)phenyl]-3-(2,6-dichloro-4-pyridinyl)urea (PubChem CID 175721929) has the molecular formula C13H7Cl3F3N3O2 and a molecular weight of 400.57 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethoxy)phenyl]-3-(2,6-dichloro-4-pyridinyl)urea.
| Compound Name | 1-[3-chloro-5-(trifluoromethoxy)phenyl]-3-(2,6-dichloro-4-pyridinyl)urea |
|---|---|
| PubChem CID | 175721929 |
| Molecular Formula | C13H7Cl3F3N3O2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 398.96 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethoxy)phenyl]-3-(2,6-dichloro-4-pyridinyl)urea |
| SMILES | O=C(Nc1cc(Cl)cc(OC(F)(F)F)c1)Nc1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C13H7Cl3F3N3O2/c14-6-1-7(3-9(2-6)24-13(17,18)19)20-12(23)21-8-4-10(15)22-11(16)5-8/h1-5H,(H2,20,21,22,23) |
| InChIKey | XQXFAXDIZKTMLK-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|