C15H11BrClF3N2O3 — CID 166747576
1-[3-bromo-2-(hydroxymethyl)phenyl]-3-[3-chloro-5-(trifluoromethoxy)phenyl]urea (PubChem CID 166747576) has the molecular formula C15H11BrClF3N2O3 and a molecular weight of 439.62 g/mol. Its IUPAC name is 1-[3-bromo-2-(hydroxymethyl)phenyl]-3-[3-chloro-5-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[3-bromo-2-(hydroxymethyl)phenyl]-3-[3-chloro-5-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 166747576 |
| Molecular Formula | C15H11BrClF3N2O3 |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 437.96 |
| IUPAC Name | 1-[3-bromo-2-(hydroxymethyl)phenyl]-3-[3-chloro-5-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(Nc1cc(Cl)cc(OC(F)(F)F)c1)Nc1cccc(Br)c1CO |
| InChI | InChI=1S/C15H11BrClF3N2O3/c16-12-2-1-3-13(11(12)7-23)22-14(24)21-9-4-8(17)5-10(6-9)25-15(18,19)20/h1-6,23H,7H2,(H2,21,22,24) |
| InChIKey | UQTONZQJTVDEQJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |