C23H36BNO2 — CID 58591527
tert-butyl N-[1-(3-tert-butylphenyl)-4-dimethylboranylcyclohex-3-en-1-yl]carbamate (PubChem CID 58591527) has the molecular formula C23H36BNO2 and a molecular weight of 369.36 g/mol. Its IUPAC name is tert-butyl N-[1-(3-tert-butylphenyl)-4-dimethylboranylcyclohex-3-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[1-(3-tert-butylphenyl)-4-dimethylboranylcyclohex-3-en-1-yl]carbamate |
|---|---|
| PubChem CID | 58591527 |
| Molecular Formula | C23H36BNO2 |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.28 |
| IUPAC Name | tert-butyl N-[1-(3-tert-butylphenyl)-4-dimethylboranylcyclohex-3-en-1-yl]carbamate |
| SMILES | CB(C)C1=CCC(NC(=O)OC(C)(C)C)(c2cccc(C(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C23H36BNO2/c1-21(2,3)17-10-9-11-18(16-17)23(25-20(26)27-22(4,5)6)14-12-19(13-15-23)24(7)8/h9-12,16H,13-15H2,1-8H3,(H,25,26) |
| InChIKey | OTEIPCUQMGLYAR-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|