C18H24ClNO4 — CID 166069954
tert-butyl N-[1-(2-chlorophenyl)-3-methoxy-2-oxocyclohexyl]carbamate (PubChem CID 166069954) has the molecular formula C18H24ClNO4 and a molecular weight of 353.85 g/mol. Its IUPAC name is tert-butyl N-[1-(2-chlorophenyl)-3-methoxy-2-oxocyclohexyl]carbamate.
| Compound Name | tert-butyl N-[1-(2-chlorophenyl)-3-methoxy-2-oxocyclohexyl]carbamate |
|---|---|
| PubChem CID | 166069954 |
| Molecular Formula | C18H24ClNO4 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | tert-butyl N-[1-(2-chlorophenyl)-3-methoxy-2-oxocyclohexyl]carbamate |
| SMILES | COC1CCCC(NC(=O)OC(C)(C)C)(c2ccccc2Cl)C1=O |
| InChI | InChI=1S/C18H24ClNO4/c1-17(2,3)24-16(22)20-18(12-8-5-6-9-13(12)19)11-7-10-14(23-4)15(18)21/h5-6,8-9,14H,7,10-11H2,1-4H3,(H,20,22) |
| InChIKey | GYDFBIZARYCWEP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |