C14H18ClNO — CID 176774253
(2R)-2-(2-chlorophenyl)-6-methyl-2-(methylamino)cyclohexan-1-one (PubChem CID 176774253) has the molecular formula C14H18ClNO and a molecular weight of 251.76 g/mol. Its IUPAC name is (2R)-2-(2-chlorophenyl)-6-methyl-2-(methylamino)cyclohexan-1-one.
| Compound Name | (2R)-2-(2-chlorophenyl)-6-methyl-2-(methylamino)cyclohexan-1-one |
|---|---|
| PubChem CID | 176774253 |
| Molecular Formula | C14H18ClNO |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | (2R)-2-(2-chlorophenyl)-6-methyl-2-(methylamino)cyclohexan-1-one |
| SMILES | CN[C@@]1(c2ccccc2Cl)CCCC(C)C1=O |
| InChI | InChI=1S/C14H18ClNO/c1-10-6-5-9-14(16-2,13(10)17)11-7-3-4-8-12(11)15/h3-4,7-8,10,16H,5-6,9H2,1-2H3/t10?,14-/m1/s1 |
| InChIKey | GDXHMRSBFPOZGR-LNUXAPHWSA-N |
| XLogP | 3.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |