C13H14B2ClNO — CID 145384807
CID 145384807 (PubChem CID 145384807) has the molecular formula C13H14B2ClNO and a molecular weight of 257.34 g/mol.
| Compound Name | CID 145384807 |
|---|---|
| PubChem CID | 145384807 |
| Molecular Formula | C13H14B2ClNO |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | — |
| SMILES | [B]C1([B])CCC[C@](NC)(c2ccccc2Cl)C1=O |
| InChI | InChI=1S/C13H14B2ClNO/c1-17-12(9-5-2-3-6-10(9)16)7-4-8-13(14,15)11(12)18/h2-3,5-6,17H,4,7-8H2,1H3/t12-/m0/s1 |
| InChIKey | PKRUJUMHLLTEDM-LBPRGKRZSA-N |
| XLogP | 1.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|