C20H23ClN2O — CID 140649030
(2E)-1-(2-chlorophenyl)-N-methyl-2-phenylmethoxyiminocyclohexan-1-amine (PubChem CID 140649030) has the molecular formula C20H23ClN2O and a molecular weight of 342.87 g/mol. Its IUPAC name is (2E)-1-(2-chlorophenyl)-N-methyl-2-phenylmethoxyiminocyclohexan-1-amine.
| Compound Name | (2E)-1-(2-chlorophenyl)-N-methyl-2-phenylmethoxyiminocyclohexan-1-amine |
|---|---|
| PubChem CID | 140649030 |
| Molecular Formula | C20H23ClN2O |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (2E)-1-(2-chlorophenyl)-N-methyl-2-phenylmethoxyiminocyclohexan-1-amine |
| SMILES | CNC1(c2ccccc2Cl)CCCC/C1=N\OCc1ccccc1 |
| InChI | InChI=1S/C20H23ClN2O/c1-22-20(17-11-5-6-12-18(17)21)14-8-7-13-19(20)23-24-15-16-9-3-2-4-10-16/h2-6,9-12,22H,7-8,13-15H2,1H3/b23-19+ |
| InChIKey | MNLFIQLULGHRMU-FCDQGJHFSA-N |
| XLogP | 4.90 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|