About (2E)-1-(3,4-dichlorophenyl)-N-methyl-2-phenylmethoxyiminocyclohexane-1-carbothioamide
(2E)-1-(3,4-dichlorophenyl)-N-methyl-2-phenylmethoxyiminocyclohexane-1-carbothioamide (PubChem CID 18649766) has the molecular formula C21H22Cl2N2OS
and a molecular weight of 421.39 g/mol. Its IUPAC name is (2E)-1-(3,4-dichlorophenyl)-N-methyl-2-phenylmethoxyiminocyclohexane-1-carbothioamide.
Molecular Properties
| Compound Name | (2E)-1-(3,4-dichlorophenyl)-N-methyl-2-phenylmethoxyiminocyclohexane-1-carbothioamide |
| PubChem CID | 18649766 |
| Molecular Formula | C21H22Cl2N2OS |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | (2E)-1-(3,4-dichlorophenyl)-N-methyl-2-phenylmethoxyiminocyclohexane-1-carbothioamide |
| SMILES | CNC(=S)C1(c2ccc(Cl)c(Cl)c2)CCCC/C1=N\OCc1ccccc1 |
| InChI | InChI=1S/C21H22Cl2N2OS/c1-24-20(27)21(16-10-11-17(22)18(23)13-16)12-6-5-9-19(21)25-26-14-15-7-3-2-4-8-15/h2-4,7-8,10-11,13H,5-6,9,12,14H2,1H3,(H,24,27)/b25-19+ |
| InChIKey | PEJJHOHWOICDII-NCELDCMTSA-N |
| XLogP | 5.92 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2E)-1-(3,4-dichlorophenyl)-N-methyl-2-phenylmethoxyiminocyclohexane-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-1-(3,4-dichlorophenyl)-N-methyl-2-phenylmethoxyiminocyclohexane-1-carbothioamide?
The IUPAC name of (2E)-1-(3,4-dichlorophenyl)-N-methyl-2-phenylmethoxyiminocyclohexane-1-carbothioamide (CID 18649766) is (2E)-1-(3,4-dichlorophenyl)-N-methyl-2-phenylmethoxyiminocyclohexane-1-carbothioamide.
What is the SMILES notation for (2E)-1-(3,4-dichlorophenyl)-N-methyl-2-phenylmethoxyiminocyclohexane-1-carbothioamide?
The canonical SMILES for (2E)-1-(3,4-dichlorophenyl)-N-methyl-2-phenylmethoxyiminocyclohexane-1-carbothioamide is CNC(=S)C1(c2ccc(Cl)c(Cl)c2)CCCC/C1=N\OCc1ccccc1.
What is the InChIKey of (2E)-1-(3,4-dichlorophenyl)-N-methyl-2-phenylmethoxyiminocyclohexane-1-carbothioamide?
The InChIKey is PEJJHOHWOICDII-NCELDCMTSA-N. The full InChI is InChI=1S/C21H22Cl2N2OS/c1-24-20(27)21(16-10-11-17(22)18(23)13-16)12-6-5-9-19(21)25-26-14-15-7-3-2-4-8-15/h2-4,7-8,10-11,13H,5-6,9,12,14H2,1H3,(H,24,27)/b25-19+.
What are the key properties of (2E)-1-(3,4-dichlorophenyl)-N-methyl-2-phenylmethoxyiminocyclohexane-1-carbothioamide?
(2E)-1-(3,4-dichlorophenyl)-N-methyl-2-phenylmethoxyiminocyclohexane-1-carbothioamide has a molecular weight of 421.39 g/mol, XLogP of 5.92, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-1-(3,4-dichlorophenyl)-N-methyl-2-phenylmethoxyiminocyclohexane-1-carbothioamide is sourced from PubChem (CID 18649766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).