C13H15Cl2NOS2 — CID 173365790
(1R,2S)-2-(3,4-dichlorophenyl)-N-methyl-1-oxothiane-2-carbothioamide (PubChem CID 173365790) has the molecular formula C13H15Cl2NOS2 and a molecular weight of 336.31 g/mol. Its IUPAC name is (1R,2S)-2-(3,4-dichlorophenyl)-N-methyl-1-oxothiane-2-carbothioamide.
| Compound Name | (1R,2S)-2-(3,4-dichlorophenyl)-N-methyl-1-oxothiane-2-carbothioamide |
|---|---|
| PubChem CID | 173365790 |
| Molecular Formula | C13H15Cl2NOS2 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | (1R,2S)-2-(3,4-dichlorophenyl)-N-methyl-1-oxothiane-2-carbothioamide |
| SMILES | CNC(=S)[C@@]1(c2ccc(Cl)c(Cl)c2)CCCC[S@]1=O |
| InChI | InChI=1S/C13H15Cl2NOS2/c1-16-12(18)13(6-2-3-7-19(13)17)9-4-5-10(14)11(15)8-9/h4-5,8H,2-3,6-7H2,1H3,(H,16,18)/t13-,19+/m0/s1 |
| InChIKey | SQCDUJNKCKBSSC-ORAYPTAESA-N |
| XLogP | 3.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|