C14H16Cl2O2 — CID 134167029
1-(3,4-dichlorophenyl)-4-hydroxy-4-methylcyclohexane-1-carbaldehyde (PubChem CID 134167029) has the molecular formula C14H16Cl2O2 and a molecular weight of 287.19 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-4-hydroxy-4-methylcyclohexane-1-carbaldehyde.
| Compound Name | 1-(3,4-dichlorophenyl)-4-hydroxy-4-methylcyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 134167029 |
| Molecular Formula | C14H16Cl2O2 |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-4-hydroxy-4-methylcyclohexane-1-carbaldehyde |
| SMILES | CC1(O)CCC(C=O)(c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H16Cl2O2/c1-13(18)4-6-14(9-17,7-5-13)10-2-3-11(15)12(16)8-10/h2-3,8-9,18H,4-7H2,1H3 |
| InChIKey | PAQBIARMLGOJHE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|