C17H21Cl2NO3 — CID 87531508
tert-butyl 3-(3,4-dichlorophenyl)-3-formylpiperidine-1-carboxylate (PubChem CID 87531508) has the molecular formula C17H21Cl2NO3 and a molecular weight of 358.27 g/mol. Its IUPAC name is tert-butyl 3-(3,4-dichlorophenyl)-3-formylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(3,4-dichlorophenyl)-3-formylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 87531508 |
| Molecular Formula | C17H21Cl2NO3 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | tert-butyl 3-(3,4-dichlorophenyl)-3-formylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C=O)(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C17H21Cl2NO3/c1-16(2,3)23-15(22)20-8-4-7-17(10-20,11-21)12-5-6-13(18)14(19)9-12/h5-6,9,11H,4,7-8,10H2,1-3H3 |
| InChIKey | GCFFCCTUFICHHJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|