C18H23Cl2NO3 — CID 25133965
tert-butyl 3-(3,4-dichlorophenyl)-3-prop-2-enoxypyrrolidine-1-carboxylate (PubChem CID 25133965) has the molecular formula C18H23Cl2NO3 and a molecular weight of 372.29 g/mol. Its IUPAC name is tert-butyl 3-(3,4-dichlorophenyl)-3-prop-2-enoxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(3,4-dichlorophenyl)-3-prop-2-enoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 25133965 |
| Molecular Formula | C18H23Cl2NO3 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | tert-butyl 3-(3,4-dichlorophenyl)-3-prop-2-enoxypyrrolidine-1-carboxylate |
| SMILES | C=CCOC1(c2ccc(Cl)c(Cl)c2)CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H23Cl2NO3/c1-5-10-23-18(13-6-7-14(19)15(20)11-13)8-9-21(12-18)16(22)24-17(2,3)4/h5-7,11H,1,8-10,12H2,2-4H3 |
| InChIKey | BVWDLFDFULYZHT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|