C20H25Cl2NO3 — CID 163711978
tert-butyl 4-(3,4-dichlorophenyl)-4-[(E)-3-oxobut-1-enyl]piperidine-1-carboxylate (PubChem CID 163711978) has the molecular formula C20H25Cl2NO3 and a molecular weight of 398.33 g/mol. Its IUPAC name is tert-butyl 4-(3,4-dichlorophenyl)-4-[(E)-3-oxobut-1-enyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3,4-dichlorophenyl)-4-[(E)-3-oxobut-1-enyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 163711978 |
| Molecular Formula | C20H25Cl2NO3 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | tert-butyl 4-(3,4-dichlorophenyl)-4-[(E)-3-oxobut-1-enyl]piperidine-1-carboxylate |
| SMILES | CC(=O)/C=C/C1(c2ccc(Cl)c(Cl)c2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H25Cl2NO3/c1-14(24)7-8-20(15-5-6-16(21)17(22)13-15)9-11-23(12-10-20)18(25)26-19(2,3)4/h5-8,13H,9-12H2,1-4H3/b8-7+ |
| InChIKey | KKAPRHYOSXHBSZ-BQYQJAHWSA-N |
| XLogP | 5.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|