C19H29Cl2NO3 — CID 156723494
tert-butyl pyrrolidine-1-carboxylate;1,2-dichloro-4-methoxybenzene;prop-1-ene (PubChem CID 156723494) has the molecular formula C19H29Cl2NO3 and a molecular weight of 390.35 g/mol. Its IUPAC name is tert-butyl pyrrolidine-1-carboxylate;1,2-dichloro-4-methoxybenzene;prop-1-ene.
| Compound Name | tert-butyl pyrrolidine-1-carboxylate;1,2-dichloro-4-methoxybenzene;prop-1-ene |
|---|---|
| PubChem CID | 156723494 |
| Molecular Formula | C19H29Cl2NO3 |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | tert-butyl pyrrolidine-1-carboxylate;1,2-dichloro-4-methoxybenzene;prop-1-ene |
| SMILES | C=CC.CC(C)(C)OC(=O)N1CCCC1.COc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H17NO2.C7H6Cl2O.C3H6/c1-9(2,3)12-8(11)10-6-4-5-7-10;1-10-5-2-3-6(8)7(9)4-5;1-3-2/h4-7H2,1-3H3;2-4H,1H3;3H,1H2,2H3 |
| InChIKey | BYFCDDFDDMIMTG-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|