C17H19NOS2 — CID 173365830
(1R,2S)-N-methyl-2-naphthalen-2-yl-1-oxothiane-2-carbothioamide (PubChem CID 173365830) has the molecular formula C17H19NOS2 and a molecular weight of 317.48 g/mol. Its IUPAC name is (1R,2S)-N-methyl-2-naphthalen-2-yl-1-oxothiane-2-carbothioamide.
| Compound Name | (1R,2S)-N-methyl-2-naphthalen-2-yl-1-oxothiane-2-carbothioamide |
|---|---|
| PubChem CID | 173365830 |
| Molecular Formula | C17H19NOS2 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | (1R,2S)-N-methyl-2-naphthalen-2-yl-1-oxothiane-2-carbothioamide |
| SMILES | CNC(=S)[C@@]1(c2ccc3ccccc3c2)CCCC[S@]1=O |
| InChI | InChI=1S/C17H19NOS2/c1-18-16(20)17(10-4-5-11-21(17)19)15-9-8-13-6-2-3-7-14(13)12-15/h2-3,6-9,12H,4-5,10-11H2,1H3,(H,18,20)/t17-,21+/m0/s1 |
| InChIKey | OJKPLLZCMMCLDL-LAUBAEHRSA-N |
| XLogP | 3.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|