C25H27NO4 — CID 174575958
benzene-1,3-dicarboxylic acid;N-methyl-1-naphthalen-2-ylcyclohexan-1-amine (PubChem CID 174575958) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is benzene-1,3-dicarboxylic acid;N-methyl-1-naphthalen-2-ylcyclohexan-1-amine.
| Compound Name | benzene-1,3-dicarboxylic acid;N-methyl-1-naphthalen-2-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 174575958 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | benzene-1,3-dicarboxylic acid;N-methyl-1-naphthalen-2-ylcyclohexan-1-amine |
| SMILES | CNC1(c2ccc3ccccc3c2)CCCCC1.O=C(O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C17H21N.C8H6O4/c1-18-17(11-5-2-6-12-17)16-10-9-14-7-3-4-8-15(14)13-16;9-7(10)5-2-1-3-6(4-5)8(11)12/h3-4,7-10,13,18H,2,5-6,11-12H2,1H3;1-4H,(H,9,10)(H,11,12) |
| InChIKey | VWWLOFPUEATGRH-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |