C24H25N3OS — CID 54491759
N-methyl-2-phenylmethoxyimino-1-quinolin-3-ylcyclohexane-1-carbothioamide (PubChem CID 54491759) has the molecular formula C24H25N3OS and a molecular weight of 403.55 g/mol. Its IUPAC name is N-methyl-2-phenylmethoxyimino-1-quinolin-3-ylcyclohexane-1-carbothioamide.
| Compound Name | N-methyl-2-phenylmethoxyimino-1-quinolin-3-ylcyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 54491759 |
| Molecular Formula | C24H25N3OS |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-methyl-2-phenylmethoxyimino-1-quinolin-3-ylcyclohexane-1-carbothioamide |
| SMILES | CNC(=S)C1(c2cnc3ccccc3c2)CCCCC1=NOCc1ccccc1 |
| InChI | InChI=1S/C24H25N3OS/c1-25-23(29)24(20-15-19-11-5-6-12-21(19)26-16-20)14-8-7-13-22(24)27-28-17-18-9-3-2-4-10-18/h2-6,9-12,15-16H,7-8,13-14,17H2,1H3,(H,25,29) |
| InChIKey | XWFQNHSGAKCBCD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|