C22H24FN3OS — CID 10340768
(2E)-2-[(2E)-2-[(4-fluorophenyl)methoxyimino]ethylidene]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide (PubChem CID 10340768) has the molecular formula C22H24FN3OS and a molecular weight of 397.52 g/mol. Its IUPAC name is (2E)-2-[(2E)-2-[(4-fluorophenyl)methoxyimino]ethylidene]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide.
| Compound Name | (2E)-2-[(2E)-2-[(4-fluorophenyl)methoxyimino]ethylidene]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 10340768 |
| Molecular Formula | C22H24FN3OS |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | (2E)-2-[(2E)-2-[(4-fluorophenyl)methoxyimino]ethylidene]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide |
| SMILES | CNC(=S)C1(c2cccnc2)CCCC/C1=C\C=N\OCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H24FN3OS/c1-24-21(28)22(19-6-4-13-25-15-19)12-3-2-5-18(22)11-14-26-27-16-17-7-9-20(23)10-8-17/h4,6-11,13-15H,2-3,5,12,16H2,1H3,(H,24,28)/b18-11+,26-14+ |
| InChIKey | ZUXRGZZTGUJCBX-OYQYLWLUSA-N |
| XLogP | 4.71 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|