C22H23NOS2 — CID 54110171
1-[2-(2-phenoxyethylidene)-1-pyridin-3-ylcyclohexyl]propane-1,2-dithione (PubChem CID 54110171) has the molecular formula C22H23NOS2 and a molecular weight of 381.57 g/mol. Its IUPAC name is 1-[2-(2-phenoxyethylidene)-1-pyridin-3-ylcyclohexyl]propane-1,2-dithione.
| Compound Name | 1-[2-(2-phenoxyethylidene)-1-pyridin-3-ylcyclohexyl]propane-1,2-dithione |
|---|---|
| PubChem CID | 54110171 |
| Molecular Formula | C22H23NOS2 |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 1-[2-(2-phenoxyethylidene)-1-pyridin-3-ylcyclohexyl]propane-1,2-dithione |
| SMILES | CC(=S)C(=S)C1(c2cccnc2)CCCCC1=CCOc1ccccc1 |
| InChI | InChI=1S/C22H23NOS2/c1-17(25)21(26)22(19-9-7-14-23-16-19)13-6-5-8-18(22)12-15-24-20-10-3-2-4-11-20/h2-4,7,9-12,14,16H,5-6,8,13,15H2,1H3 |
| InChIKey | NGNIIERBPXDHIO-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|