C21H25N3OS — CID 57111639
2-[(1S)-2-[(1S)-1-hydroxy-1-phenylethyl]imino-1-pyridin-3-ylcyclohexyl]ethanethioamide (PubChem CID 57111639) has the molecular formula C21H25N3OS and a molecular weight of 367.52 g/mol. Its IUPAC name is 2-[(1S)-2-[(1S)-1-hydroxy-1-phenylethyl]imino-1-pyridin-3-ylcyclohexyl]ethanethioamide.
| Compound Name | 2-[(1S)-2-[(1S)-1-hydroxy-1-phenylethyl]imino-1-pyridin-3-ylcyclohexyl]ethanethioamide |
|---|---|
| PubChem CID | 57111639 |
| Molecular Formula | C21H25N3OS |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 2-[(1S)-2-[(1S)-1-hydroxy-1-phenylethyl]imino-1-pyridin-3-ylcyclohexyl]ethanethioamide |
| SMILES | C[C@@](O)(N=C1CCCC[C@]1(CC(N)=S)c1cccnc1)c1ccccc1 |
| InChI | InChI=1S/C21H25N3OS/c1-20(25,16-8-3-2-4-9-16)24-18-11-5-6-12-21(18,14-19(22)26)17-10-7-13-23-15-17/h2-4,7-10,13,15,25H,5-6,11-12,14H2,1H3,(H2,22,26)/t20-,21-/m0/s1 |
| InChIKey | LAGNFJZAONWAJJ-SFTDATJTSA-N |
| XLogP | 3.88 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|