C20H18F5N3OS — CID 54302302
N-methyl-2-[(2,3,4,5,6-pentafluorophenyl)methoxyimino]-1-pyridin-3-ylcyclohexane-1-carbothioamide (PubChem CID 54302302) has the molecular formula C20H18F5N3OS and a molecular weight of 443.44 g/mol. Its IUPAC name is N-methyl-2-[(2,3,4,5,6-pentafluorophenyl)methoxyimino]-1-pyridin-3-ylcyclohexane-1-carbothioamide.
| Compound Name | N-methyl-2-[(2,3,4,5,6-pentafluorophenyl)methoxyimino]-1-pyridin-3-ylcyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 54302302 |
| Molecular Formula | C20H18F5N3OS |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | N-methyl-2-[(2,3,4,5,6-pentafluorophenyl)methoxyimino]-1-pyridin-3-ylcyclohexane-1-carbothioamide |
| SMILES | CNC(=S)C1(c2cccnc2)CCCCC1=NOCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H18F5N3OS/c1-26-19(30)20(11-5-4-8-27-9-11)7-3-2-6-13(20)28-29-10-12-14(21)16(23)18(25)17(24)15(12)22/h4-5,8-9H,2-3,6-7,10H2,1H3,(H,26,30) |
| InChIKey | SFCBBKVMOXIDCM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|