C27H38N4O3S — CID 19876069
(2Z)-2-[[4-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]methoxyimino]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide (PubChem CID 19876069) has the molecular formula C27H38N4O3S and a molecular weight of 498.69 g/mol. Its IUPAC name is (2Z)-2-[[4-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]methoxyimino]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide.
| Compound Name | (2Z)-2-[[4-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]methoxyimino]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 19876069 |
| Molecular Formula | C27H38N4O3S |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | (2Z)-2-[[4-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]methoxyimino]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide |
| SMILES | CNC(=S)C1(c2cccnc2)CCCC/C1=N/OCc1ccc(OCC(O)CNC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H38N4O3S/c1-26(2,3)30-17-22(32)19-33-23-12-10-20(11-13-23)18-34-31-24-9-5-6-14-27(24,25(35)28-4)21-8-7-15-29-16-21/h7-8,10-13,15-16,22,30,32H,5-6,9,14,17-19H2,1-4H3,(H,28,35)/b31-24- |
| InChIKey | OFZPAPXNERQVPC-QLTSDVKISA-N |
| XLogP | 4.14 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|