C20H26N2O4 — CID 15574706
benzyl 5-[3-(tert-butylamino)-2-hydroxypropoxy]pyridine-2-carboxylate (PubChem CID 15574706) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is benzyl 5-[3-(tert-butylamino)-2-hydroxypropoxy]pyridine-2-carboxylate.
| Compound Name | benzyl 5-[3-(tert-butylamino)-2-hydroxypropoxy]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 15574706 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | benzyl 5-[3-(tert-butylamino)-2-hydroxypropoxy]pyridine-2-carboxylate |
| SMILES | CC(C)(C)NCC(O)COc1ccc(C(=O)OCc2ccccc2)nc1 |
| InChI | InChI=1S/C20H26N2O4/c1-20(2,3)22-11-16(23)14-25-17-9-10-18(21-12-17)19(24)26-13-15-7-5-4-6-8-15/h4-10,12,16,22-23H,11,13-14H2,1-3H3 |
| InChIKey | CGFQKELSOGSICI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |