C22H23NO2S2 — CID 57307167
2-[2-[2-(4-hydroxyphenoxy)ethylidene]-1-pyridin-3-ylcyclohexyl]propanedithial (PubChem CID 57307167) has the molecular formula C22H23NO2S2 and a molecular weight of 397.57 g/mol. Its IUPAC name is 2-[2-[2-(4-hydroxyphenoxy)ethylidene]-1-pyridin-3-ylcyclohexyl]propanedithial.
| Compound Name | 2-[2-[2-(4-hydroxyphenoxy)ethylidene]-1-pyridin-3-ylcyclohexyl]propanedithial |
|---|---|
| PubChem CID | 57307167 |
| Molecular Formula | C22H23NO2S2 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-[2-[2-(4-hydroxyphenoxy)ethylidene]-1-pyridin-3-ylcyclohexyl]propanedithial |
| SMILES | Oc1ccc(OCC=C2CCCCC2(c2cccnc2)C(C=S)C=S)cc1 |
| InChI | InChI=1S/C22H23NO2S2/c24-20-6-8-21(9-7-20)25-13-10-17-4-1-2-11-22(17,19(15-26)16-27)18-5-3-12-23-14-18/h3,5-10,12,14-16,19,24H,1-2,4,11,13H2 |
| InChIKey | AGPCBFLQWGQESL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|