About [(1R,2S)-2-(methylcarbamothioyl)-2-quinolin-3-ylcyclohexyl] benzoate
[(1R,2S)-2-(methylcarbamothioyl)-2-quinolin-3-ylcyclohexyl] benzoate (PubChem CID 22847527) has the molecular formula C24H24N2O2S
and a molecular weight of 404.54 g/mol. Its IUPAC name is [(1R,2S)-2-(methylcarbamothioyl)-2-quinolin-3-ylcyclohexyl] benzoate.
Molecular Properties
| Compound Name | [(1R,2S)-2-(methylcarbamothioyl)-2-quinolin-3-ylcyclohexyl] benzoate |
| PubChem CID | 22847527 |
| Molecular Formula | C24H24N2O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | [(1R,2S)-2-(methylcarbamothioyl)-2-quinolin-3-ylcyclohexyl] benzoate |
| SMILES | CNC(=S)[C@]1(c2cnc3ccccc3c2)CCCC[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O2S/c1-25-23(29)24(19-15-18-11-5-6-12-20(18)26-16-19)14-8-7-13-21(24)28-22(27)17-9-3-2-4-10-17/h2-6,9-12,15-16,21H,7-8,13-14H2,1H3,(H,25,29)/t21-,24+/m1/s1 |
| InChIKey | PASSJQFEWLCOCW-QPPBQGQZSA-N |
| XLogP | 4.82 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2S)-2-(methylcarbamothioyl)-2-quinolin-3-ylcyclohexyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-2-(methylcarbamothioyl)-2-quinolin-3-ylcyclohexyl] benzoate?
The IUPAC name of [(1R,2S)-2-(methylcarbamothioyl)-2-quinolin-3-ylcyclohexyl] benzoate (CID 22847527) is [(1R,2S)-2-(methylcarbamothioyl)-2-quinolin-3-ylcyclohexyl] benzoate.
What is the SMILES notation for [(1R,2S)-2-(methylcarbamothioyl)-2-quinolin-3-ylcyclohexyl] benzoate?
The canonical SMILES for [(1R,2S)-2-(methylcarbamothioyl)-2-quinolin-3-ylcyclohexyl] benzoate is CNC(=S)[C@]1(c2cnc3ccccc3c2)CCCC[C@H]1OC(=O)c1ccccc1.
What is the InChIKey of [(1R,2S)-2-(methylcarbamothioyl)-2-quinolin-3-ylcyclohexyl] benzoate?
The InChIKey is PASSJQFEWLCOCW-QPPBQGQZSA-N. The full InChI is InChI=1S/C24H24N2O2S/c1-25-23(29)24(19-15-18-11-5-6-12-20(18)26-16-19)14-8-7-13-21(24)28-22(27)17-9-3-2-4-10-17/h2-6,9-12,15-16,21H,7-8,13-14H2,1H3,(H,25,29)/t21-,24+/m1/s1.
What are the key properties of [(1R,2S)-2-(methylcarbamothioyl)-2-quinolin-3-ylcyclohexyl] benzoate?
[(1R,2S)-2-(methylcarbamothioyl)-2-quinolin-3-ylcyclohexyl] benzoate has a molecular weight of 404.54 g/mol, XLogP of 4.82, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-2-(methylcarbamothioyl)-2-quinolin-3-ylcyclohexyl] benzoate is sourced from PubChem (CID 22847527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).