C24H24N2O2S — CID 22847527
[(1R,2S)-2-(methylcarbamothioyl)-2-quinolin-3-ylcyclohexyl] benzoate (PubChem CID 22847527) has the molecular formula C24H24N2O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is [(1R,2S)-2-(methylcarbamothioyl)-2-quinolin-3-ylcyclohexyl] benzoate.
| Compound Name | [(1R,2S)-2-(methylcarbamothioyl)-2-quinolin-3-ylcyclohexyl] benzoate |
|---|---|
| PubChem CID | 22847527 |
| Molecular Formula | C24H24N2O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | [(1R,2S)-2-(methylcarbamothioyl)-2-quinolin-3-ylcyclohexyl] benzoate |
| SMILES | CNC(=S)[C@]1(c2cnc3ccccc3c2)CCCC[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O2S/c1-25-23(29)24(19-15-18-11-5-6-12-20(18)26-16-19)14-8-7-13-21(24)28-22(27)17-9-3-2-4-10-17/h2-6,9-12,15-16,21H,7-8,13-14H2,1H3,(H,25,29)/t21-,24+/m1/s1 |
| InChIKey | PASSJQFEWLCOCW-QPPBQGQZSA-N |
| XLogP | 4.82 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|