C13H14ClNO4 — CID 138596675
[(1R,3S)-1-(2-chlorophenyl)-3-hydroxy-2-oxocyclohexyl]carbamic acid (PubChem CID 138596675) has the molecular formula C13H14ClNO4 and a molecular weight of 283.71 g/mol. Its IUPAC name is [(1R,3S)-1-(2-chlorophenyl)-3-hydroxy-2-oxocyclohexyl]carbamic acid.
| Compound Name | [(1R,3S)-1-(2-chlorophenyl)-3-hydroxy-2-oxocyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 138596675 |
| Molecular Formula | C13H14ClNO4 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | [(1R,3S)-1-(2-chlorophenyl)-3-hydroxy-2-oxocyclohexyl]carbamic acid |
| SMILES | O=C(O)N[C@@]1(c2ccccc2Cl)CCC[C@H](O)C1=O |
| InChI | InChI=1S/C13H14ClNO4/c14-9-5-2-1-4-8(9)13(15-12(18)19)7-3-6-10(16)11(13)17/h1-2,4-5,10,15-16H,3,6-7H2,(H,18,19)/t10-,13+/m0/s1 |
| InChIKey | RSOKNMIHUCDZEZ-GXFFZTMASA-N |
| XLogP | 1.92 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |