C16H18ClNO6 — CID 153294611
(2S)-2-[[(1R,3S)-1-(2-chlorophenyl)-3-hydroxy-2-oxocyclohexyl]amino]-3-formyloxypropanoic acid (PubChem CID 153294611) has the molecular formula C16H18ClNO6 and a molecular weight of 355.77 g/mol. Its IUPAC name is (2S)-2-[[(1R,3S)-1-(2-chlorophenyl)-3-hydroxy-2-oxocyclohexyl]amino]-3-formyloxypropanoic acid.
| Compound Name | (2S)-2-[[(1R,3S)-1-(2-chlorophenyl)-3-hydroxy-2-oxocyclohexyl]amino]-3-formyloxypropanoic acid |
|---|---|
| PubChem CID | 153294611 |
| Molecular Formula | C16H18ClNO6 |
| Molecular Weight | 355.77 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | (2S)-2-[[(1R,3S)-1-(2-chlorophenyl)-3-hydroxy-2-oxocyclohexyl]amino]-3-formyloxypropanoic acid |
| SMILES | O=COC[C@H](N[C@@]1(c2ccccc2Cl)CCC[C@H](O)C1=O)C(=O)O |
| InChI | InChI=1S/C16H18ClNO6/c17-11-5-2-1-4-10(11)16(7-3-6-13(20)14(16)21)18-12(15(22)23)8-24-9-19/h1-2,4-5,9,12-13,18,20H,3,6-8H2,(H,22,23)/t12-,13-,16+/m0/s1 |
| InChIKey | MUFWUAZEFVYNDM-HEHGZKQESA-N |
| XLogP | 0.87 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.77 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|