C17H20ClNO6 — CID 153294619
(2S)-2-[[(1S,3R)-1-(2-chlorophenyl)-3-hydroxy-2-oxocyclohexyl]-methylamino]-3-formyloxypropanoic acid (PubChem CID 153294619) has the molecular formula C17H20ClNO6 and a molecular weight of 369.80 g/mol. Its IUPAC name is (2S)-2-[[(1S,3R)-1-(2-chlorophenyl)-3-hydroxy-2-oxocyclohexyl]-methylamino]-3-formyloxypropanoic acid.
| Compound Name | (2S)-2-[[(1S,3R)-1-(2-chlorophenyl)-3-hydroxy-2-oxocyclohexyl]-methylamino]-3-formyloxypropanoic acid |
|---|---|
| PubChem CID | 153294619 |
| Molecular Formula | C17H20ClNO6 |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | (2S)-2-[[(1S,3R)-1-(2-chlorophenyl)-3-hydroxy-2-oxocyclohexyl]-methylamino]-3-formyloxypropanoic acid |
| SMILES | CN([C@@H](COC=O)C(=O)O)[C@]1(c2ccccc2Cl)CCC[C@@H](O)C1=O |
| InChI | InChI=1S/C17H20ClNO6/c1-19(13(16(23)24)9-25-10-20)17(8-4-7-14(21)15(17)22)11-5-2-3-6-12(11)18/h2-3,5-6,10,13-14,21H,4,7-9H2,1H3,(H,23,24)/t13-,14+,17-/m0/s1 |
| InChIKey | SXQKJLHAULWIAQ-VBQJREDUSA-N |
| XLogP | 1.21 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|