C20H19NO5 — CID 10991812
[(1R,3S)-3-methyl-2-oxo-3-phenylcyclohexyl] 4-nitrobenzoate (PubChem CID 10991812) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is [(1R,3S)-3-methyl-2-oxo-3-phenylcyclohexyl] 4-nitrobenzoate.
| Compound Name | [(1R,3S)-3-methyl-2-oxo-3-phenylcyclohexyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 10991812 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | [(1R,3S)-3-methyl-2-oxo-3-phenylcyclohexyl] 4-nitrobenzoate |
| SMILES | C[C@@]1(c2ccccc2)CCC[C@@H](OC(=O)c2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C20H19NO5/c1-20(15-6-3-2-4-7-15)13-5-8-17(18(20)22)26-19(23)14-9-11-16(12-10-14)21(24)25/h2-4,6-7,9-12,17H,5,8,13H2,1H3/t17-,20+/m1/s1 |
| InChIKey | JBCUOIGUNHAHOZ-XLIONFOSSA-N |
| XLogP | 3.83 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|