C16H17NO5 — CID 98513144
[(1S,2R,5S)-9-oxo-2-bicyclo[3.3.1]nonanyl] 4-nitrobenzoate (PubChem CID 98513144) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is [(1S,2R,5S)-9-oxo-2-bicyclo[3.3.1]nonanyl] 4-nitrobenzoate.
| Compound Name | [(1S,2R,5S)-9-oxo-2-bicyclo[3.3.1]nonanyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 98513144 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | [(1S,2R,5S)-9-oxo-2-bicyclo[3.3.1]nonanyl] 4-nitrobenzoate |
| SMILES | O=C(O[C@@H]1CC[C@@H]2CCC[C@@H]1C2=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H17NO5/c18-15-10-2-1-3-13(15)14(9-6-10)22-16(19)11-4-7-12(8-5-11)17(20)21/h4-5,7-8,10,13-14H,1-3,6,9H2/t10-,13-,14+/m0/s1 |
| InChIKey | NAJGMLORGKZFRW-LEWSCRJBSA-N |
| XLogP | 2.90 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|