C14H15NO6 — CID 100921649
[(1R,5S,8R)-2,9-dioxabicyclo[3.3.1]nonan-8-yl] 4-nitrobenzoate (PubChem CID 100921649) has the molecular formula C14H15NO6 and a molecular weight of 293.27 g/mol. Its IUPAC name is [(1R,5S,8R)-2,9-dioxabicyclo[3.3.1]nonan-8-yl] 4-nitrobenzoate.
| Compound Name | [(1R,5S,8R)-2,9-dioxabicyclo[3.3.1]nonan-8-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 100921649 |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | [(1R,5S,8R)-2,9-dioxabicyclo[3.3.1]nonan-8-yl] 4-nitrobenzoate |
| SMILES | O=C(O[C@@H]1CC[C@H]2CCO[C@@H]1O2)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H15NO6/c16-13(9-1-3-10(4-2-9)15(17)18)21-12-6-5-11-7-8-19-14(12)20-11/h1-4,11-12,14H,5-8H2/t11-,12+,14+/m0/s1 |
| InChIKey | ITIBZOXJYFWSFV-OUCADQQQSA-N |
| XLogP | 2.05 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|