C17H21BrFNO4 — CID 142342188
tert-butyl N-[(3S,4S)-3-(5-bromo-2-fluorophenyl)-4-formyl-5-methyloxolan-3-yl]carbamate (PubChem CID 142342188) has the molecular formula C17H21BrFNO4 and a molecular weight of 402.26 g/mol. Its IUPAC name is tert-butyl N-[(3S,4S)-3-(5-bromo-2-fluorophenyl)-4-formyl-5-methyloxolan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4S)-3-(5-bromo-2-fluorophenyl)-4-formyl-5-methyloxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 142342188 |
| Molecular Formula | C17H21BrFNO4 |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | tert-butyl N-[(3S,4S)-3-(5-bromo-2-fluorophenyl)-4-formyl-5-methyloxolan-3-yl]carbamate |
| SMILES | CC1OC[C@@](NC(=O)OC(C)(C)C)(c2cc(Br)ccc2F)[C@@H]1C=O |
| InChI | InChI=1S/C17H21BrFNO4/c1-10-13(8-21)17(9-23-10,20-15(22)24-16(2,3)4)12-7-11(18)5-6-14(12)19/h5-8,10,13H,9H2,1-4H3,(H,20,22)/t10?,13-,17-/m1/s1 |
| InChIKey | BDPGWDDAWSTCMP-USEQNBQGSA-N |
| XLogP | 3.54 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|