C25H26BrF2N3O4 — CID 121372458
tert-butyl N-[(4aR,6R,8aS)-8a-(5-bromo-2-fluorophenyl)-6-(4-fluorophenyl)-3-methyl-4-oxo-4a,5,6,8-tetrahydropyrano[3,4-d]pyrimidin-2-yl]carbamate (PubChem CID 121372458) has the molecular formula C25H26BrF2N3O4 and a molecular weight of 550.40 g/mol. Its IUPAC name is tert-butyl N-[(4aR,6R,8aS)-8a-(5-bromo-2-fluorophenyl)-6-(4-fluorophenyl)-3-methyl-4-oxo-4a,5,6,8-tetrahydropyrano[3,4-d]pyrimidin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(4aR,6R,8aS)-8a-(5-bromo-2-fluorophenyl)-6-(4-fluorophenyl)-3-methyl-4-oxo-4a,5,6,8-tetrahydropyrano[3,4-d]pyrimidin-2-yl]carbamate |
|---|---|
| PubChem CID | 121372458 |
| Molecular Formula | C25H26BrF2N3O4 |
| Molecular Weight | 550.40 g/mol |
| Exact Mass | 549.11 |
| IUPAC Name | tert-butyl N-[(4aR,6R,8aS)-8a-(5-bromo-2-fluorophenyl)-6-(4-fluorophenyl)-3-methyl-4-oxo-4a,5,6,8-tetrahydropyrano[3,4-d]pyrimidin-2-yl]carbamate |
| SMILES | CN1C(=O)[C@@H]2C[C@H](c3ccc(F)cc3)OC[C@]2(c2cc(Br)ccc2F)N=C1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H26BrF2N3O4/c1-24(2,3)35-23(33)29-22-30-25(17-11-15(26)7-10-19(17)28)13-34-20(12-18(25)21(32)31(22)4)14-5-8-16(27)9-6-14/h5-11,18,20H,12-13H2,1-4H3,(H,29,30,33)/t18-,20+,25+/m0/s1 |
| InChIKey | VECAAQUVUOWRHX-DMJCMNNJSA-N |
| XLogP | 5.05 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |