C33H31BrFNO4 — CID 134460222
N-[(3S,4R,5S)-3-(5-bromo-2-fluorophenyl)-4-(hydroxymethyl)-5-(trityloxymethyl)oxolan-3-yl]acetamide (PubChem CID 134460222) has the molecular formula C33H31BrFNO4 and a molecular weight of 604.52 g/mol. Its IUPAC name is N-[(3S,4R,5S)-3-(5-bromo-2-fluorophenyl)-4-(hydroxymethyl)-5-(trityloxymethyl)oxolan-3-yl]acetamide.
| Compound Name | N-[(3S,4R,5S)-3-(5-bromo-2-fluorophenyl)-4-(hydroxymethyl)-5-(trityloxymethyl)oxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 134460222 |
| Molecular Formula | C33H31BrFNO4 |
| Molecular Weight | 604.52 g/mol |
| Exact Mass | 603.14 |
| IUPAC Name | N-[(3S,4R,5S)-3-(5-bromo-2-fluorophenyl)-4-(hydroxymethyl)-5-(trityloxymethyl)oxolan-3-yl]acetamide |
| SMILES | CC(=O)N[C@@]1(c2cc(Br)ccc2F)CO[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1CO |
| InChI | InChI=1S/C33H31BrFNO4/c1-23(38)36-32(28-19-27(34)17-18-30(28)35)22-39-31(29(32)20-37)21-40-33(24-11-5-2-6-12-24,25-13-7-3-8-14-25)26-15-9-4-10-16-26/h2-19,29,31,37H,20-22H2,1H3,(H,36,38)/t29-,31-,32-/m1/s1 |
| InChIKey | RDIBNJGZROJQHG-AFEGNUHBSA-N |
| XLogP | 5.94 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.52 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|