C31H35BrFNO3 — CID 139364832
[(2S,3R,4S)-4-amino-4-(5-bromo-2-fluorophenyl)-2-[[(3Z,5Z)-1-cyclohexa-1,3-dien-1-yl-1-phenylhepta-3,5-dienoxy]methyl]oxolan-3-yl]methanol (PubChem CID 139364832) has the molecular formula C31H35BrFNO3 and a molecular weight of 568.53 g/mol. Its IUPAC name is [(2S,3R,4S)-4-amino-4-(5-bromo-2-fluorophenyl)-2-[[(3Z,5Z)-1-cyclohexa-1,3-dien-1-yl-1-phenylhepta-3,5-dienoxy]methyl]oxolan-3-yl]methanol.
| Compound Name | [(2S,3R,4S)-4-amino-4-(5-bromo-2-fluorophenyl)-2-[[(3Z,5Z)-1-cyclohexa-1,3-dien-1-yl-1-phenylhepta-3,5-dienoxy]methyl]oxolan-3-yl]methanol |
|---|---|
| PubChem CID | 139364832 |
| Molecular Formula | C31H35BrFNO3 |
| Molecular Weight | 568.53 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | [(2S,3R,4S)-4-amino-4-(5-bromo-2-fluorophenyl)-2-[[(3Z,5Z)-1-cyclohexa-1,3-dien-1-yl-1-phenylhepta-3,5-dienoxy]methyl]oxolan-3-yl]methanol |
| SMILES | C/C=C\C=C/CC(OC[C@H]1OC[C@@](N)(c2cc(Br)ccc2F)[C@@H]1CO)(C1=CC=CCC1)c1ccccc1 |
| InChI | InChI=1S/C31H35BrFNO3/c1-2-3-4-11-18-31(23-12-7-5-8-13-23,24-14-9-6-10-15-24)37-21-29-27(20-35)30(34,22-36-29)26-19-25(32)16-17-28(26)33/h2-9,11-14,16-17,19,27,29,35H,10,15,18,20-22,34H2,1H3/b3-2-,11-4-/t27-,29-,30-,31?/m1/s1 |
| InChIKey | BOSHRTWCGOVKFA-PVEFDRJYSA-N |
| XLogP | 6.46 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.53 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|