C14H15BrFNO4 — CID 151756084
(3aR,4S,6aS)-6a-(5-bromo-2-fluorophenyl)-1-ethyl-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazole-4-carboxylic acid (PubChem CID 151756084) has the molecular formula C14H15BrFNO4 and a molecular weight of 360.18 g/mol. Its IUPAC name is (3aR,4S,6aS)-6a-(5-bromo-2-fluorophenyl)-1-ethyl-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazole-4-carboxylic acid.
| Compound Name | (3aR,4S,6aS)-6a-(5-bromo-2-fluorophenyl)-1-ethyl-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 151756084 |
| Molecular Formula | C14H15BrFNO4 |
| Molecular Weight | 360.18 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | (3aR,4S,6aS)-6a-(5-bromo-2-fluorophenyl)-1-ethyl-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazole-4-carboxylic acid |
| SMILES | CCN1OC[C@@H]2[C@@H](C(=O)O)OC[C@@]21c1cc(Br)ccc1F |
| InChI | InChI=1S/C14H15BrFNO4/c1-2-17-14(9-5-8(15)3-4-11(9)16)7-20-12(13(18)19)10(14)6-21-17/h3-5,10,12H,2,6-7H2,1H3,(H,18,19)/t10-,12+,14-/m1/s1 |
| InChIKey | RPOISVYJQXPVSK-SCDSUCTJSA-N |
| XLogP | 2.15 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.18 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |