C18H24BrFN2O2 — CID 159812832
(4aR,6S,8aS)-8a-(5-bromo-2-fluorophenyl)-6-ethyl-3-methyl-2-methylidene-4a,5,6,8-tetrahydro-1H-pyrano[3,4-d]pyrimidin-4-one;methane (PubChem CID 159812832) has the molecular formula C18H24BrFN2O2 and a molecular weight of 399.30 g/mol. Its IUPAC name is (4aR,6S,8aS)-8a-(5-bromo-2-fluorophenyl)-6-ethyl-3-methyl-2-methylidene-4a,5,6,8-tetrahydro-1H-pyrano[3,4-d]pyrimidin-4-one;methane.
| Compound Name | (4aR,6S,8aS)-8a-(5-bromo-2-fluorophenyl)-6-ethyl-3-methyl-2-methylidene-4a,5,6,8-tetrahydro-1H-pyrano[3,4-d]pyrimidin-4-one;methane |
|---|---|
| PubChem CID | 159812832 |
| Molecular Formula | C18H24BrFN2O2 |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | (4aR,6S,8aS)-8a-(5-bromo-2-fluorophenyl)-6-ethyl-3-methyl-2-methylidene-4a,5,6,8-tetrahydro-1H-pyrano[3,4-d]pyrimidin-4-one;methane |
| SMILES | C.C=C1N[C@@]2(c3cc(Br)ccc3F)CO[C@@H](CC)C[C@H]2C(=O)N1C |
| InChI | InChI=1S/C17H20BrFN2O2.CH4/c1-4-12-8-14-16(22)21(3)10(2)20-17(14,9-23-12)13-7-11(18)5-6-15(13)19;/h5-7,12,14,20H,2,4,8-9H2,1,3H3;1H4/t12-,14-,17+;/m0./s1 |
| InChIKey | NLGCUMPREDMEPC-DOZSWSKFSA-N |
| XLogP | 3.77 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |