C18H23BrFNO3S — CID 160657936
(4aS,8aR)-4a-(5-bromo-2-fluorophenyl)-2,2,7,7-tetramethyl-3-methylidene-4,5,8,8a-tetrahydropyrano[4,3-b][1,4]thiazine 1,1-dioxide (PubChem CID 160657936) has the molecular formula C18H23BrFNO3S and a molecular weight of 432.36 g/mol. Its IUPAC name is (4aS,8aR)-4a-(5-bromo-2-fluorophenyl)-2,2,7,7-tetramethyl-3-methylidene-4,5,8,8a-tetrahydropyrano[4,3-b][1,4]thiazine 1,1-dioxide.
| Compound Name | (4aS,8aR)-4a-(5-bromo-2-fluorophenyl)-2,2,7,7-tetramethyl-3-methylidene-4,5,8,8a-tetrahydropyrano[4,3-b][1,4]thiazine 1,1-dioxide |
|---|---|
| PubChem CID | 160657936 |
| Molecular Formula | C18H23BrFNO3S |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | (4aS,8aR)-4a-(5-bromo-2-fluorophenyl)-2,2,7,7-tetramethyl-3-methylidene-4,5,8,8a-tetrahydropyrano[4,3-b][1,4]thiazine 1,1-dioxide |
| SMILES | C=C1N[C@@]2(c3cc(Br)ccc3F)COC(C)(C)C[C@H]2S(=O)(=O)C1(C)C |
| InChI | InChI=1S/C18H23BrFNO3S/c1-11-17(4,5)25(22,23)15-9-16(2,3)24-10-18(15,21-11)13-8-12(19)6-7-14(13)20/h6-8,15,21H,1,9-10H2,2-5H3/t15-,18-/m1/s1 |
| InChIKey | WYYAQOCCERZZNR-CRAIPNDOSA-N |
| XLogP | 3.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |