C12H13BrFNO2 — CID 122549659
(3aR,6aS)-6a-(5-bromo-2-fluorophenyl)-1,3,3a,4,5,6-hexahydrocyclopenta[c][1,2]oxazol-5-ol (PubChem CID 122549659) has the molecular formula C12H13BrFNO2 and a molecular weight of 302.14 g/mol. Its IUPAC name is (3aR,6aS)-6a-(5-bromo-2-fluorophenyl)-1,3,3a,4,5,6-hexahydrocyclopenta[c][1,2]oxazol-5-ol.
| Compound Name | (3aR,6aS)-6a-(5-bromo-2-fluorophenyl)-1,3,3a,4,5,6-hexahydrocyclopenta[c][1,2]oxazol-5-ol |
|---|---|
| PubChem CID | 122549659 |
| Molecular Formula | C12H13BrFNO2 |
| Molecular Weight | 302.14 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | (3aR,6aS)-6a-(5-bromo-2-fluorophenyl)-1,3,3a,4,5,6-hexahydrocyclopenta[c][1,2]oxazol-5-ol |
| SMILES | OC1C[C@H]2CON[C@@]2(c2cc(Br)ccc2F)C1 |
| InChI | InChI=1S/C12H13BrFNO2/c13-8-1-2-11(14)10(4-8)12-5-9(16)3-7(12)6-17-15-12/h1-2,4,7,9,15-16H,3,5-6H2/t7-,9?,12-/m0/s1 |
| InChIKey | BIIJXUOWMFJYGW-HSIUBREASA-N |
| XLogP | 2.09 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.14 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |