C20H20BrF2NO3 — CID 86721296
(3aR,5R,7aS)-7a-(5-bromo-2,4-difluorophenyl)-5-(phenylmethoxymethyl)-1,3,3a,4,5,7-hexahydropyrano[3,4-c][1,2]oxazole (PubChem CID 86721296) has the molecular formula C20H20BrF2NO3 and a molecular weight of 440.28 g/mol. Its IUPAC name is (3aR,5R,7aS)-7a-(5-bromo-2,4-difluorophenyl)-5-(phenylmethoxymethyl)-1,3,3a,4,5,7-hexahydropyrano[3,4-c][1,2]oxazole.
| Compound Name | (3aR,5R,7aS)-7a-(5-bromo-2,4-difluorophenyl)-5-(phenylmethoxymethyl)-1,3,3a,4,5,7-hexahydropyrano[3,4-c][1,2]oxazole |
|---|---|
| PubChem CID | 86721296 |
| Molecular Formula | C20H20BrF2NO3 |
| Molecular Weight | 440.28 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | (3aR,5R,7aS)-7a-(5-bromo-2,4-difluorophenyl)-5-(phenylmethoxymethyl)-1,3,3a,4,5,7-hexahydropyrano[3,4-c][1,2]oxazole |
| SMILES | Fc1cc(F)c([C@]23CO[C@@H](COCc4ccccc4)C[C@H]2CON3)cc1Br |
| InChI | InChI=1S/C20H20BrF2NO3/c21-17-7-16(18(22)8-19(17)23)20-12-26-15(6-14(20)10-27-24-20)11-25-9-13-4-2-1-3-5-13/h1-5,7-8,14-15,24H,6,9-12H2/t14-,15+,20-/m0/s1 |
| InChIKey | OUTDQAIPDVSAAA-MDOVXXIYSA-N |
| XLogP | 4.08 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.28 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|