C20H22FNO2 — CID 67477921
(3aR,6R,7aS)-7a-(2-fluorophenyl)-6-phenylmethoxy-3,3a,4,5,6,7-hexahydro-1H-2,1-benzoxazole (PubChem CID 67477921) has the molecular formula C20H22FNO2 and a molecular weight of 327.40 g/mol. Its IUPAC name is (3aR,6R,7aS)-7a-(2-fluorophenyl)-6-phenylmethoxy-3,3a,4,5,6,7-hexahydro-1H-2,1-benzoxazole.
| Compound Name | (3aR,6R,7aS)-7a-(2-fluorophenyl)-6-phenylmethoxy-3,3a,4,5,6,7-hexahydro-1H-2,1-benzoxazole |
|---|---|
| PubChem CID | 67477921 |
| Molecular Formula | C20H22FNO2 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (3aR,6R,7aS)-7a-(2-fluorophenyl)-6-phenylmethoxy-3,3a,4,5,6,7-hexahydro-1H-2,1-benzoxazole |
| SMILES | Fc1ccccc1[C@]12C[C@H](OCc3ccccc3)CC[C@H]1CON2 |
| InChI | InChI=1S/C20H22FNO2/c21-19-9-5-4-8-18(19)20-12-17(11-10-16(20)14-24-22-20)23-13-15-6-2-1-3-7-15/h1-9,16-17,22H,10-14H2/t16-,17+,20-/m0/s1 |
| InChIKey | IKPREIUKZCDAAK-QKLQHJQFSA-N |
| XLogP | 3.94 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |