C20H19F3O2 — CID 157091197
(3aS,5S,6aR)-5-[(3,4-difluorophenyl)methoxy]-3a-(2-fluorophenyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]furan (PubChem CID 157091197) has the molecular formula C20H19F3O2 and a molecular weight of 348.36 g/mol. Its IUPAC name is (3aS,5S,6aR)-5-[(3,4-difluorophenyl)methoxy]-3a-(2-fluorophenyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]furan.
| Compound Name | (3aS,5S,6aR)-5-[(3,4-difluorophenyl)methoxy]-3a-(2-fluorophenyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]furan |
|---|---|
| PubChem CID | 157091197 |
| Molecular Formula | C20H19F3O2 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (3aS,5S,6aR)-5-[(3,4-difluorophenyl)methoxy]-3a-(2-fluorophenyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]furan |
| SMILES | Fc1ccc(CO[C@H]2C[C@H]3COC[C@@]3(c3ccccc3F)C2)cc1F |
| InChI | InChI=1S/C20H19F3O2/c21-17-4-2-1-3-16(17)20-9-15(8-14(20)11-24-12-20)25-10-13-5-6-18(22)19(23)7-13/h1-7,14-15H,8-12H2/t14-,15-,20-/m0/s1 |
| InChIKey | RGNLGLVAZISQEA-AVYPCKFXSA-N |
| XLogP | 4.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |