C14H17FO2 — CID 59621298
(3aR,6R,6aR)-6-ethyl-3a-(2-fluorophenyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan (PubChem CID 59621298) has the molecular formula C14H17FO2 and a molecular weight of 236.29 g/mol. Its IUPAC name is (3aR,6R,6aR)-6-ethyl-3a-(2-fluorophenyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan.
| Compound Name | (3aR,6R,6aR)-6-ethyl-3a-(2-fluorophenyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan |
|---|---|
| PubChem CID | 59621298 |
| Molecular Formula | C14H17FO2 |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (3aR,6R,6aR)-6-ethyl-3a-(2-fluorophenyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan |
| SMILES | CC[C@H]1OC[C@]2(c3ccccc3F)COC[C@H]12 |
| InChI | InChI=1S/C14H17FO2/c1-2-13-11-7-16-8-14(11,9-17-13)10-5-3-4-6-12(10)15/h3-6,11,13H,2,7-9H2,1H3/t11-,13-,14+/m1/s1 |
| InChIKey | GGMIRGKNKSVXQF-BNOWGMLFSA-N |
| XLogP | 2.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |