C14H17FO2 — CID 58406095
(3aR,7aR)-3a-(2-fluorophenyl)-7-methyl-1,3,4,6,7,7a-hexahydrofuro[3,4-c]pyran (PubChem CID 58406095) has the molecular formula C14H17FO2 and a molecular weight of 236.29 g/mol. Its IUPAC name is (3aR,7aR)-3a-(2-fluorophenyl)-7-methyl-1,3,4,6,7,7a-hexahydrofuro[3,4-c]pyran.
| Compound Name | (3aR,7aR)-3a-(2-fluorophenyl)-7-methyl-1,3,4,6,7,7a-hexahydrofuro[3,4-c]pyran |
|---|---|
| PubChem CID | 58406095 |
| Molecular Formula | C14H17FO2 |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (3aR,7aR)-3a-(2-fluorophenyl)-7-methyl-1,3,4,6,7,7a-hexahydrofuro[3,4-c]pyran |
| SMILES | CC1COC[C@]2(c3ccccc3F)COC[C@H]12 |
| InChI | InChI=1S/C14H17FO2/c1-10-6-16-8-14(9-17-7-12(10)14)11-4-2-3-5-13(11)15/h2-5,10,12H,6-9H2,1H3/t10?,12-,14-/m1/s1 |
| InChIKey | YVXBWJWAQHRRNO-HCGVIMEBSA-N |
| XLogP | 2.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |