C16H22FNO4 — CID 77467008
tert-butyl N-[3-(2-fluorophenyl)-4-(hydroxymethyl)oxolan-3-yl]carbamate (PubChem CID 77467008) has the molecular formula C16H22FNO4 and a molecular weight of 311.35 g/mol. Its IUPAC name is tert-butyl N-[3-(2-fluorophenyl)-4-(hydroxymethyl)oxolan-3-yl]carbamate.
| Compound Name | tert-butyl N-[3-(2-fluorophenyl)-4-(hydroxymethyl)oxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 77467008 |
| Molecular Formula | C16H22FNO4 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | tert-butyl N-[3-(2-fluorophenyl)-4-(hydroxymethyl)oxolan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccccc2F)COCC1CO |
| InChI | InChI=1S/C16H22FNO4/c1-15(2,3)22-14(20)18-16(10-21-9-11(16)8-19)12-6-4-5-7-13(12)17/h4-7,11,19H,8-10H2,1-3H3,(H,18,20) |
| InChIKey | PCXXXOBWHGQMHL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |