C20H27FN2O6S — CID 118553306
tert-butyl N-[(4aS,7aS)-4a-(2-fluorophenyl)-7-(hydroxymethyl)-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-3-yl]carbamate (PubChem CID 118553306) has the molecular formula C20H27FN2O6S and a molecular weight of 442.51 g/mol. Its IUPAC name is tert-butyl N-[(4aS,7aS)-4a-(2-fluorophenyl)-7-(hydroxymethyl)-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(4aS,7aS)-4a-(2-fluorophenyl)-7-(hydroxymethyl)-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-3-yl]carbamate |
|---|---|
| PubChem CID | 118553306 |
| Molecular Formula | C20H27FN2O6S |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | tert-butyl N-[(4aS,7aS)-4a-(2-fluorophenyl)-7-(hydroxymethyl)-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=N[C@@]2(c3ccccc3F)COC(CO)[C@H]2S(=O)(=O)C1(C)C |
| InChI | InChI=1S/C20H27FN2O6S/c1-18(2,3)29-17(25)22-16-19(4,5)30(26,27)15-14(10-24)28-11-20(15,23-16)12-8-6-7-9-13(12)21/h6-9,14-15,24H,10-11H2,1-5H3,(H,22,23,25)/t14?,15-,20-/m1/s1 |
| InChIKey | MMHWUOQXIHWASW-XUERPSFUSA-N |
| XLogP | 1.91 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |