C23H35FN2O6S — CID 154978928
tert-butyl N-[(2R,3S)-3-(2-fluorophenyl)-3-(hydroxymethyl)-2-(2-hydroxy-3-methylbutyl)-6,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]carbamate (PubChem CID 154978928) has the molecular formula C23H35FN2O6S and a molecular weight of 486.61 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-3-(2-fluorophenyl)-3-(hydroxymethyl)-2-(2-hydroxy-3-methylbutyl)-6,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-3-(2-fluorophenyl)-3-(hydroxymethyl)-2-(2-hydroxy-3-methylbutyl)-6,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]carbamate |
|---|---|
| PubChem CID | 154978928 |
| Molecular Formula | C23H35FN2O6S |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | tert-butyl N-[(2R,3S)-3-(2-fluorophenyl)-3-(hydroxymethyl)-2-(2-hydroxy-3-methylbutyl)-6,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]carbamate |
| SMILES | CC(C)C(O)C[C@@H]1[C@@](CO)(c2ccccc2F)N=C(NC(=O)OC(C)(C)C)C(C)(C)S1(=O)=O |
| InChI | InChI=1S/C23H35FN2O6S/c1-14(2)17(28)12-18-23(13-27,15-10-8-9-11-16(15)24)26-19(22(6,7)33(18,30)31)25-20(29)32-21(3,4)5/h8-11,14,17-18,27-28H,12-13H2,1-7H3,(H,25,26,29)/t17?,18-,23-/m1/s1 |
| InChIKey | GKFVHWIKAVCFIB-ZAZMHIJSSA-N |
| XLogP | 2.92 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |