C21H28F4IN3O3S — CID 155155883
tert-butyl N-[(1S,5S)-5-(2-fluoro-5-iodophenyl)-2,2,5-trimethyl-1-oxo-1-(2,2,2-trifluoroethylimino)-6,7-dihydro-1,4-thiazepin-3-yl]carbamate (PubChem CID 155155883) has the molecular formula C21H28F4IN3O3S and a molecular weight of 605.44 g/mol. Its IUPAC name is tert-butyl N-[(1S,5S)-5-(2-fluoro-5-iodophenyl)-2,2,5-trimethyl-1-oxo-1-(2,2,2-trifluoroethylimino)-6,7-dihydro-1,4-thiazepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,5S)-5-(2-fluoro-5-iodophenyl)-2,2,5-trimethyl-1-oxo-1-(2,2,2-trifluoroethylimino)-6,7-dihydro-1,4-thiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 155155883 |
| Molecular Formula | C21H28F4IN3O3S |
| Molecular Weight | 605.44 g/mol |
| Exact Mass | 605.08 |
| IUPAC Name | tert-butyl N-[(1S,5S)-5-(2-fluoro-5-iodophenyl)-2,2,5-trimethyl-1-oxo-1-(2,2,2-trifluoroethylimino)-6,7-dihydro-1,4-thiazepin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=N[C@](C)(c2cc(I)ccc2F)CC[S@@](=O)(=NCC(F)(F)F)C1(C)C |
| InChI | InChI=1S/C21H28F4IN3O3S/c1-18(2,3)32-17(30)28-16-19(4,5)33(31,27-12-21(23,24)25)10-9-20(6,29-16)14-11-13(26)7-8-15(14)22/h7-8,11H,9-10,12H2,1-6H3,(H,28,29,30)/t20-,33-/m0/s1 |
| InChIKey | DNXODUCTDGTDOQ-KGMZSHBCSA-N |
| XLogP | 5.78 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|