C17H21FINO2S — CID 58376930
tert-butyl N-[(4R)-4-(2-fluoro-5-iodophenyl)-4-methyl-2,3-dihydrothiopyran-6-yl]carbamate (PubChem CID 58376930) has the molecular formula C17H21FINO2S and a molecular weight of 449.33 g/mol. Its IUPAC name is tert-butyl N-[(4R)-4-(2-fluoro-5-iodophenyl)-4-methyl-2,3-dihydrothiopyran-6-yl]carbamate.
| Compound Name | tert-butyl N-[(4R)-4-(2-fluoro-5-iodophenyl)-4-methyl-2,3-dihydrothiopyran-6-yl]carbamate |
|---|---|
| PubChem CID | 58376930 |
| Molecular Formula | C17H21FINO2S |
| Molecular Weight | 449.33 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | tert-butyl N-[(4R)-4-(2-fluoro-5-iodophenyl)-4-methyl-2,3-dihydrothiopyran-6-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=C[C@](C)(c2cc(I)ccc2F)CCS1 |
| InChI | InChI=1S/C17H21FINO2S/c1-16(2,3)22-15(21)20-14-10-17(4,7-8-23-14)12-9-11(19)5-6-13(12)18/h5-6,9-10H,7-8H2,1-4H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | BQFCLSCVOPCNSZ-QGZVFWFLSA-N |
| XLogP | 5.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.33 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|